C18H24ClN3O3 — CID 138959888
1-(4-chlorophenoxy)-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propan-2-ol (PubChem CID 138959888) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 138959888 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propan-2-ol |
| SMILES | Cc1cnn(CC2CN(CC(O)COc3ccc(Cl)cc3)CCO2)c1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-14-8-20-22(9-14)12-18-11-21(6-7-24-18)10-16(23)13-25-17-4-2-15(19)3-5-17/h2-5,8-9,16,18,23H,6-7,10-13H2,1H3 |
| InChIKey | IWFVBEBBSIBHJW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |