C20H27N3O4 — CID 138959906
1-[4-[2-hydroxy-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propoxy]phenyl]ethanone (PubChem CID 138959906) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propoxy]phenyl]ethanone.
| Compound Name | 1-[4-[2-hydroxy-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 138959906 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[4-[2-hydroxy-3-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC(O)CN2CCOC(Cn3cc(C)cn3)C2)cc1 |
| InChI | InChI=1S/C20H27N3O4/c1-15-9-21-23(10-15)13-20-12-22(7-8-26-20)11-18(25)14-27-19-5-3-17(4-6-19)16(2)24/h3-6,9-10,18,20,25H,7-8,11-14H2,1-2H3 |
| InChIKey | NEJWQUUENWNFOD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |