C37H31N3O — CID 138963531
(1R,2S,3R,4R,5R)-3-ethenyl-8'-methyl-2,4-diphenylspiro[6-azatricyclo[4.3.0.02,4]nonane-5,6'-indolo[2,1-b]quinazoline]-12'-one (PubChem CID 138963531) has the molecular formula C37H31N3O and a molecular weight of 533.68 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-3-ethenyl-8'-methyl-2,4-diphenylspiro[6-azatricyclo[4.3.0.02,4]nonane-5,6'-indolo[2,1-b]quinazoline]-12'-one.
| Compound Name | (1R,2S,3R,4R,5R)-3-ethenyl-8'-methyl-2,4-diphenylspiro[6-azatricyclo[4.3.0.02,4]nonane-5,6'-indolo[2,1-b]quinazoline]-12'-one |
|---|---|
| PubChem CID | 138963531 |
| Molecular Formula | C37H31N3O |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | (1R,2S,3R,4R,5R)-3-ethenyl-8'-methyl-2,4-diphenylspiro[6-azatricyclo[4.3.0.02,4]nonane-5,6'-indolo[2,1-b]quinazoline]-12'-one |
| SMILES | C=C[C@@H]1[C@@]2(c3ccccc3)[C@H]3CCCN3[C@@]3(c4cc(C)ccc4-n4c3nc3ccccc3c4=O)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C37H31N3O/c1-3-31-35(25-13-6-4-7-14-25)32-19-12-22-39(32)37(36(31,35)26-15-8-5-9-16-26)28-23-24(2)20-21-30(28)40-33(41)27-17-10-11-18-29(27)38-34(37)40/h3-11,13-18,20-21,23,31-32H,1,12,19,22H2,2H3/t31-,32-,35+,36+,37-/m1/s1 |
| InChIKey | CIBZCYMBZCDLBG-ZDTJJXJUSA-N |
| XLogP | 6.42 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|