C15H21NS — CID 138963743
2,2-dimethyl-1-[(2R)-2-phenylpyrrolidin-1-yl]propane-1-thione (PubChem CID 138963743) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2R)-2-phenylpyrrolidin-1-yl]propane-1-thione.
| Compound Name | 2,2-dimethyl-1-[(2R)-2-phenylpyrrolidin-1-yl]propane-1-thione |
|---|---|
| PubChem CID | 138963743 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2,2-dimethyl-1-[(2R)-2-phenylpyrrolidin-1-yl]propane-1-thione |
| SMILES | CC(C)(C)C(=S)N1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H21NS/c1-15(2,3)14(17)16-11-7-10-13(16)12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | SUWOMBAPXCKRKP-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|