C17H25NS — CID 138963744
2,2-dimethyl-1-[(2R)-2-phenylpiperidin-1-yl]butane-1-thione (PubChem CID 138963744) has the molecular formula C17H25NS and a molecular weight of 275.46 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2R)-2-phenylpiperidin-1-yl]butane-1-thione.
| Compound Name | 2,2-dimethyl-1-[(2R)-2-phenylpiperidin-1-yl]butane-1-thione |
|---|---|
| PubChem CID | 138963744 |
| Molecular Formula | C17H25NS |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2,2-dimethyl-1-[(2R)-2-phenylpiperidin-1-yl]butane-1-thione |
| SMILES | CCC(C)(C)C(=S)N1CCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H25NS/c1-4-17(2,3)16(19)18-13-9-8-12-15(18)14-10-6-5-7-11-14/h5-7,10-11,15H,4,8-9,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | KAOZLFRUPBNYQJ-OAHLLOKOSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|