C12H12O6S — CID 138964525
ethyl 6-methoxy-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate (PubChem CID 138964525) has the molecular formula C12H12O6S and a molecular weight of 284.29 g/mol. Its IUPAC name is ethyl 6-methoxy-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate.
| Compound Name | ethyl 6-methoxy-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate |
|---|---|
| PubChem CID | 138964525 |
| Molecular Formula | C12H12O6S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | ethyl 6-methoxy-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(OC)ccc2OS1(=O)=O |
| InChI | InChI=1S/C12H12O6S/c1-3-17-12(13)11-7-8-6-9(16-2)4-5-10(8)18-19(11,14)15/h4-7H,3H2,1-2H3 |
| InChIKey | YQJYGZXSJVUILA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|