C11H9FO5S — CID 138965120
ethyl 6-fluoro-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate (PubChem CID 138965120) has the molecular formula C11H9FO5S and a molecular weight of 272.25 g/mol. Its IUPAC name is ethyl 6-fluoro-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate.
| Compound Name | ethyl 6-fluoro-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate |
|---|---|
| PubChem CID | 138965120 |
| Molecular Formula | C11H9FO5S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | ethyl 6-fluoro-2,2-dioxo-1,2λ6-benzoxathiine-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(F)ccc2OS1(=O)=O |
| InChI | InChI=1S/C11H9FO5S/c1-2-16-11(13)10-6-7-5-8(12)3-4-9(7)17-18(10,14)15/h3-6H,2H2,1H3 |
| InChIKey | MLYQFVIFUDTZQI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|