C14H19NO5 — CID 138965652
ethyl 4-nitro-5-oxotricyclo[4.3.1.13,8]undecane-4-carboxylate (PubChem CID 138965652) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 4-nitro-5-oxotricyclo[4.3.1.13,8]undecane-4-carboxylate.
| Compound Name | ethyl 4-nitro-5-oxotricyclo[4.3.1.13,8]undecane-4-carboxylate |
|---|---|
| PubChem CID | 138965652 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethyl 4-nitro-5-oxotricyclo[4.3.1.13,8]undecane-4-carboxylate |
| SMILES | CCOC(=O)C1([N+](=O)[O-])C(=O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H19NO5/c1-2-20-13(17)14(15(18)19)11-6-8-3-9(7-11)5-10(4-8)12(14)16/h8-11H,2-7H2,1H3 |
| InChIKey | OEPRIPBGLMENII-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|