C28H33NO6 — CID 138966011
ethyl 3-[(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridin-2-yl]prop-2-enoate (PubChem CID 138966011) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is ethyl 3-[(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridin-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 138966011 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | ethyl 3-[(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H]1[C@@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO6/c1-4-31-22(30)16-15-21-23(29(21)17-19-11-7-5-8-12-19)24-25(32-18-20-13-9-6-10-14-20)26-27(33-24)35-28(2,3)34-26/h5-16,21,23-27H,4,17-18H2,1-3H3/t21-,23+,24-,25+,26-,27-,29?/m1/s1 |
| InChIKey | AKTIVHSBINKUOE-IUQWNBRFSA-N |
| XLogP | 3.82 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|