C32H57NO6Si2 — CID 138966023
[(3S,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)ethyl]-1-[(1R)-1-phenylethyl]piperidin-3-yl] acetate (PubChem CID 138966023) has the molecular formula C32H57NO6Si2 and a molecular weight of 607.98 g/mol. Its IUPAC name is [(3S,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)ethyl]-1-[(1R)-1-phenylethyl]piperidin-3-yl] acetate.
| Compound Name | [(3S,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)ethyl]-1-[(1R)-1-phenylethyl]piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 138966023 |
| Molecular Formula | C32H57NO6Si2 |
| Molecular Weight | 607.98 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | [(3S,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)ethyl]-1-[(1R)-1-phenylethyl]piperidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CN([C@H](C)c2ccccc2)[C@H](CCC2OCCO2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H57NO6Si2/c1-23(25-16-14-13-15-17-25)33-22-27(37-24(2)34)30(39-41(11,12)32(6,7)8)29(38-40(9,10)31(3,4)5)26(33)18-19-28-35-20-21-36-28/h13-17,23,26-30H,18-22H2,1-12H3/t23-,26-,27+,29+,30-/m1/s1 |
| InChIKey | NRJMPCLGKWDHGZ-GCKUQVKVSA-N |
| XLogP | 7.30 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.98 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|