C29H34N2 — CID 138966554
2,8,12-triethyl-6-pentyl-5,11-dihydroindolo[3,2-b]carbazole (PubChem CID 138966554) has the molecular formula C29H34N2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 2,8,12-triethyl-6-pentyl-5,11-dihydroindolo[3,2-b]carbazole.
| Compound Name | 2,8,12-triethyl-6-pentyl-5,11-dihydroindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 138966554 |
| Molecular Formula | C29H34N2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2,8,12-triethyl-6-pentyl-5,11-dihydroindolo[3,2-b]carbazole |
| SMILES | CCCCCc1c2[nH]c3ccc(CC)cc3c2c(CC)c2[nH]c3ccc(CC)cc3c12 |
| InChI | InChI=1S/C29H34N2/c1-5-9-10-11-21-27-23-17-19(7-3)13-15-25(23)30-28(27)20(8-4)26-22-16-18(6-2)12-14-24(22)31-29(21)26/h12-17,30-31H,5-11H2,1-4H3 |
| InChIKey | QFFCLHKGQQMSBF-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|