C17H23NO4 — CID 138966866
ethyl 1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carboxylate (PubChem CID 138966866) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl 1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carboxylate.
| Compound Name | ethyl 1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 138966866 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl 1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-2-carboxylate |
| SMILES | CCOC(=O)C1C([C@H]2COC(C)(C)O2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-4-20-16(19)15-14(13-11-21-17(2,3)22-13)18(15)10-12-8-6-5-7-9-12/h5-9,13-15H,4,10-11H2,1-3H3/t13-,14?,15?,18?/m1/s1 |
| InChIKey | RKGSDGOUCMECHP-OQDWRCPYSA-N |
| XLogP | 1.95 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|