C13H22O2Si — CID 138967824
(E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhept-2-en-6-ynal (PubChem CID 138967824) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhept-2-en-6-ynal.
| Compound Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhept-2-en-6-ynal |
|---|---|
| PubChem CID | 138967824 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhept-2-en-6-ynal |
| SMILES | C#C[C@H](C/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H22O2Si/c1-7-12(10-8-9-11-14)15-16(5,6)13(2,3)4/h1,8-9,11-12H,10H2,2-6H3/b9-8+/t12-/m1/s1 |
| InChIKey | CXGOUNDZUFALOO-IDVQTMNDSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|