C12H16OSi — CID 58512617
(E)-9-trimethylsilylnon-2-en-6,8-diynal (PubChem CID 58512617) has the molecular formula C12H16OSi and a molecular weight of 204.34 g/mol. Its IUPAC name is (E)-9-trimethylsilylnon-2-en-6,8-diynal.
| Compound Name | (E)-9-trimethylsilylnon-2-en-6,8-diynal |
|---|---|
| PubChem CID | 58512617 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (E)-9-trimethylsilylnon-2-en-6,8-diynal |
| SMILES | C[Si](C)(C)C#CC#CCC/C=C/C=O |
| InChI | InChI=1S/C12H16OSi/c1-14(2,3)12-10-8-6-4-5-7-9-11-13/h7,9,11H,4-5H2,1-3H3/b9-7+ |
| InChIKey | LXECAQSBJQXKQT-VQHVLOKHSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|