C18H15N3O — CID 138968513
5-(1-azidoethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran (PubChem CID 138968513) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-(1-azidoethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 5-(1-azidoethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 138968513 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-(1-azidoethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
| SMILES | CC(N=[N+]=[N-])c1cc2c(cc1C#Cc1ccccc1)COC2 |
| InChI | InChI=1S/C18H15N3O/c1-13(20-21-19)18-10-17-12-22-11-16(17)9-15(18)8-7-14-5-3-2-4-6-14/h2-6,9-10,13H,11-12H2,1H3 |
| InChIKey | BVNUYXUPWHMFBH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|