C24H19N3O — CID 138969783
5-(1-azido-2-phenylethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran (PubChem CID 138969783) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is 5-(1-azido-2-phenylethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 5-(1-azido-2-phenylethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 138969783 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 5-(1-azido-2-phenylethyl)-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
| SMILES | [N-]=[N+]=NC(Cc1ccccc1)c1cc2c(cc1C#Cc1ccccc1)COC2 |
| InChI | InChI=1S/C24H19N3O/c25-27-26-24(13-19-9-5-2-6-10-19)23-15-22-17-28-16-21(22)14-20(23)12-11-18-7-3-1-4-8-18/h1-10,14-15,24H,13,16-17H2 |
| InChIKey | DAGROVDBPPRZEU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|