C20H17N3O — CID 138970201
5-[azido(cyclopropyl)methyl]-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran (PubChem CID 138970201) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-[azido(cyclopropyl)methyl]-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[azido(cyclopropyl)methyl]-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 138970201 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 5-[azido(cyclopropyl)methyl]-6-(2-phenylethynyl)-1,3-dihydro-2-benzofuran |
| SMILES | [N-]=[N+]=NC(c1cc2c(cc1C#Cc1ccccc1)COC2)C1CC1 |
| InChI | InChI=1S/C20H17N3O/c21-23-22-20(15-8-9-15)19-11-18-13-24-12-17(18)10-16(19)7-6-14-4-2-1-3-5-14/h1-5,10-11,15,20H,8-9,12-13H2 |
| InChIKey | SDIFYTVMSNXURA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|