C13H17N — CID 138968734
N-hexa-4,5-dienyl-4-methylaniline (PubChem CID 138968734) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-hexa-4,5-dienyl-4-methylaniline.
| Compound Name | N-hexa-4,5-dienyl-4-methylaniline |
|---|---|
| PubChem CID | 138968734 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-hexa-4,5-dienyl-4-methylaniline |
| SMILES | C=C=CCCCNc1ccc(C)cc1 |
| InChI | InChI=1S/C13H17N/c1-3-4-5-6-11-14-13-9-7-12(2)8-10-13/h4,7-10,14H,1,5-6,11H2,2H3 |
| InChIKey | IJSBRDIHPXJODY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|