C24H24N2O6 — CID 138969300
(4S)-4-benzyl-3-[2-[(1R,2S)-2-(4-nitrophenyl)-3-oxocyclohexyl]acetyl]-1,3-oxazolidin-2-one (PubChem CID 138969300) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[2-[(1R,2S)-2-(4-nitrophenyl)-3-oxocyclohexyl]acetyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[2-[(1R,2S)-2-(4-nitrophenyl)-3-oxocyclohexyl]acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138969300 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (4S)-4-benzyl-3-[2-[(1R,2S)-2-(4-nitrophenyl)-3-oxocyclohexyl]acetyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1CCC[C@H](CC(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H24N2O6/c27-21-8-4-7-18(23(21)17-9-11-19(12-10-17)26(30)31)14-22(28)25-20(15-32-24(25)29)13-16-5-2-1-3-6-16/h1-3,5-6,9-12,18,20,23H,4,7-8,13-15H2/t18-,20+,23-/m1/s1 |
| InChIKey | OPRVVZUANKHNKR-QMHWCDLVSA-N |
| XLogP | 4.03 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|