C20H24N3O4P — CID 138969531
[(1R,2R)-2-azidocyclohexyl] dibenzyl phosphate (PubChem CID 138969531) has the molecular formula C20H24N3O4P and a molecular weight of 401.40 g/mol. Its IUPAC name is [(1R,2R)-2-azidocyclohexyl] dibenzyl phosphate.
| Compound Name | [(1R,2R)-2-azidocyclohexyl] dibenzyl phosphate |
|---|---|
| PubChem CID | 138969531 |
| Molecular Formula | C20H24N3O4P |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [(1R,2R)-2-azidocyclohexyl] dibenzyl phosphate |
| SMILES | [N-]=[N+]=N[C@@H]1CCCC[C@H]1OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H24N3O4P/c21-23-22-19-13-7-8-14-20(19)27-28(24,25-15-17-9-3-1-4-10-17)26-16-18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16H2/t19-,20-/m1/s1 |
| InChIKey | IYPZQUDEEGDTAY-WOJBJXKFSA-N |
| XLogP | 6.17 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|