About [2-(azidomethyl)phenyl]methyl dibenzyl phosphate
[2-(azidomethyl)phenyl]methyl dibenzyl phosphate (PubChem CID 138969268) has the molecular formula C22H22N3O4P
and a molecular weight of 423.41 g/mol. Its IUPAC name is [2-(azidomethyl)phenyl]methyl dibenzyl phosphate.
Molecular Properties
| Compound Name | [2-(azidomethyl)phenyl]methyl dibenzyl phosphate |
| PubChem CID | 138969268 |
| Molecular Formula | C22H22N3O4P |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [2-(azidomethyl)phenyl]methyl dibenzyl phosphate |
| SMILES | [N-]=[N+]=NCc1ccccc1COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N3O4P/c23-25-24-15-21-13-7-8-14-22(21)18-29-30(26,27-16-19-9-3-1-4-10-19)28-17-20-11-5-2-6-12-20/h1-14H,15-18H2 |
| InChIKey | WQBIXOJIYCBWDR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [2-(azidomethyl)phenyl]methyl dibenzyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azidomethyl)phenyl]methyl dibenzyl phosphate?
The IUPAC name of [2-(azidomethyl)phenyl]methyl dibenzyl phosphate (CID 138969268) is [2-(azidomethyl)phenyl]methyl dibenzyl phosphate.
What is the SMILES notation for [2-(azidomethyl)phenyl]methyl dibenzyl phosphate?
The canonical SMILES for [2-(azidomethyl)phenyl]methyl dibenzyl phosphate is [N-]=[N+]=NCc1ccccc1COP(=O)(OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of [2-(azidomethyl)phenyl]methyl dibenzyl phosphate?
The InChIKey is WQBIXOJIYCBWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N3O4P/c23-25-24-15-21-13-7-8-14-22(21)18-29-30(26,27-16-19-9-3-1-4-10-19)28-17-20-11-5-2-6-12-20/h1-14H,15-18H2.
What are the key properties of [2-(azidomethyl)phenyl]methyl dibenzyl phosphate?
[2-(azidomethyl)phenyl]methyl dibenzyl phosphate has a molecular weight of 423.41 g/mol, XLogP of 6.56, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azidomethyl)phenyl]methyl dibenzyl phosphate is sourced from PubChem (CID 138969268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).