C9H12N3O3P — CID 138969847
3-methoxy-4,7-dihydro-1H-2,4,5,6,3λ5-benzoxatriazaphosphonine 3-oxide (PubChem CID 138969847) has the molecular formula C9H12N3O3P and a molecular weight of 241.19 g/mol. Its IUPAC name is 3-methoxy-4,7-dihydro-1H-2,4,5,6,3λ5-benzoxatriazaphosphonine 3-oxide.
| Compound Name | 3-methoxy-4,7-dihydro-1H-2,4,5,6,3λ5-benzoxatriazaphosphonine 3-oxide |
|---|---|
| PubChem CID | 138969847 |
| Molecular Formula | C9H12N3O3P |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-methoxy-4,7-dihydro-1H-2,4,5,6,3λ5-benzoxatriazaphosphonine 3-oxide |
| SMILES | COP1(=O)N/N=N\Cc2ccccc2CO1 |
| InChI | InChI=1S/C9H12N3O3P/c1-14-16(13)12-11-10-6-8-4-2-3-5-9(8)7-15-16/h2-5H,6-7H2,1H3,(H,10,12,13) |
| InChIKey | GUTVYYBCSUKVCH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|