C9H12N3O3P — CID 138969093
2-methoxy-7-phenyl-6,7-dihydro-3H-1,3,4,5,2λ5-oxatriazaphosphepine 2-oxide (PubChem CID 138969093) has the molecular formula C9H12N3O3P and a molecular weight of 241.19 g/mol. Its IUPAC name is 2-methoxy-7-phenyl-6,7-dihydro-3H-1,3,4,5,2λ5-oxatriazaphosphepine 2-oxide.
| Compound Name | 2-methoxy-7-phenyl-6,7-dihydro-3H-1,3,4,5,2λ5-oxatriazaphosphepine 2-oxide |
|---|---|
| PubChem CID | 138969093 |
| Molecular Formula | C9H12N3O3P |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-methoxy-7-phenyl-6,7-dihydro-3H-1,3,4,5,2λ5-oxatriazaphosphepine 2-oxide |
| SMILES | COP1(=O)NN=NCC(c2ccccc2)O1 |
| InChI | InChI=1S/C9H12N3O3P/c1-14-16(13)12-11-10-7-9(15-16)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,10,12,13) |
| InChIKey | LNAOTBTYYKDALC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|