C15H16NO3P — CID 138969532
3-phenylmethoxy-4,5-dihydro-1H-2,4,3λ5-benzoxazaphosphepine 3-oxide (PubChem CID 138969532) has the molecular formula C15H16NO3P and a molecular weight of 289.27 g/mol. Its IUPAC name is 3-phenylmethoxy-4,5-dihydro-1H-2,4,3λ5-benzoxazaphosphepine 3-oxide.
| Compound Name | 3-phenylmethoxy-4,5-dihydro-1H-2,4,3λ5-benzoxazaphosphepine 3-oxide |
|---|---|
| PubChem CID | 138969532 |
| Molecular Formula | C15H16NO3P |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-phenylmethoxy-4,5-dihydro-1H-2,4,3λ5-benzoxazaphosphepine 3-oxide |
| SMILES | O=P1(OCc2ccccc2)NCc2ccccc2CO1 |
| InChI | InChI=1S/C15H16NO3P/c17-20(18-11-13-6-2-1-3-7-13)16-10-14-8-4-5-9-15(14)12-19-20/h1-9H,10-12H2,(H,16,17) |
| InChIKey | DXHKIFZLQAAGHZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|