C9H13OSi- — CID 138970191
(E)-(2-trimethylsilylcyclopenta-2,4-dien-1-ylidene)methanolate (PubChem CID 138970191) has the molecular formula C9H13OSi- and a molecular weight of 165.29 g/mol. Its IUPAC name is (E)-(2-trimethylsilylcyclopenta-2,4-dien-1-ylidene)methanolate.
| Compound Name | (E)-(2-trimethylsilylcyclopenta-2,4-dien-1-ylidene)methanolate |
|---|---|
| PubChem CID | 138970191 |
| Molecular Formula | C9H13OSi- |
| Molecular Weight | 165.29 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (E)-(2-trimethylsilylcyclopenta-2,4-dien-1-ylidene)methanolate |
| SMILES | C[Si](C)(C)C1=CC=C/C1=C\[O-] |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)9-6-4-5-8(9)7-10/h4-7,10H,1-3H3/p-1/b8-7+ |
| InChIKey | MMIRSCLONLAKCK-BQYQJAHWSA-M |
| XLogP | 1.60 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|