C23H25NO2 — CID 138972745
3-[(1E)-2-methoxy-4-phenylhexa-1,5-dienyl]-N,N-dimethyl-2-benzofuran-1-amine (PubChem CID 138972745) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[(1E)-2-methoxy-4-phenylhexa-1,5-dienyl]-N,N-dimethyl-2-benzofuran-1-amine.
| Compound Name | 3-[(1E)-2-methoxy-4-phenylhexa-1,5-dienyl]-N,N-dimethyl-2-benzofuran-1-amine |
|---|---|
| PubChem CID | 138972745 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[(1E)-2-methoxy-4-phenylhexa-1,5-dienyl]-N,N-dimethyl-2-benzofuran-1-amine |
| SMILES | C=CC(C/C(=C\c1oc(N(C)C)c2ccccc12)OC)c1ccccc1 |
| InChI | InChI=1S/C23H25NO2/c1-5-17(18-11-7-6-8-12-18)15-19(25-4)16-22-20-13-9-10-14-21(20)23(26-22)24(2)3/h5-14,16-17H,1,15H2,2-4H3/b19-16+ |
| InChIKey | WONZVZMNGUYPLN-KNTRCKAVSA-N |
| XLogP | 5.85 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|