About carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium
carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium (PubChem CID 138967855) has the molecular formula C17H14CrO6
and a molecular weight of 366.29 g/mol. Its IUPAC name is carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium.
Molecular Properties
| Compound Name | carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium |
| PubChem CID | 138967855 |
| Molecular Formula | C17H14CrO6 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium |
| SMILES | C=CC(CC(=[Cr])OC)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C12H14O.5CO.Cr/c1-3-11(9-10-13-2)12-7-5-4-6-8-12;5*1-2;/h3-8,11H,1,9H2,2H3;;;;;; |
| InChIKey | LAWVFNZOVWSGNC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium?
The IUPAC name of carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium (CID 138967855) is carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium.
What is the SMILES notation for carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium?
The canonical SMILES for carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium is C=CC(CC(=[Cr])OC)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium?
The InChIKey is LAWVFNZOVWSGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O.5CO.Cr/c1-3-11(9-10-13-2)12-7-5-4-6-8-12;5*1-2;/h3-8,11H,1,9H2,2H3;;;;;;.
What are the key properties of carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium?
carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium has a molecular weight of 366.29 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;(1-methoxy-3-phenylpent-4-enylidene)chromium is sourced from PubChem (CID 138967855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).