C21H16CrO6 — CID 597500
carbon monoxide;(1-methoxy-3,3-diphenylpropylidene)chromium (PubChem CID 597500) has the molecular formula C21H16CrO6 and a molecular weight of 416.35 g/mol. Its IUPAC name is carbon monoxide;(1-methoxy-3,3-diphenylpropylidene)chromium.
| Compound Name | carbon monoxide;(1-methoxy-3,3-diphenylpropylidene)chromium |
|---|---|
| PubChem CID | 597500 |
| Molecular Formula | C21H16CrO6 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | carbon monoxide;(1-methoxy-3,3-diphenylpropylidene)chromium |
| SMILES | COC(=[Cr])CC(c1ccccc1)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C16H16O.5CO.Cr/c1-17-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;5*1-2;/h2-11,16H,12H2,1H3;;;;;; |
| InChIKey | ZISKBUBULYVXSY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|