C20H17NO6 — CID 138974064
ethyl (1R)-1-[(1R)-5-methoxy-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138974064) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-5-methoxy-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-5-methoxy-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138974064 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl (1R)-1-[(1R)-5-methoxy-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H]2OC(=O)c3cc(OC)ccc32)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C20H17NO6/c1-3-26-19(24)20(15-7-5-4-6-13(15)17(22)21-20)16-12-9-8-11(25-2)10-14(12)18(23)27-16/h4-10,16H,3H2,1-2H3,(H,21,22)/t16-,20-/m1/s1 |
| InChIKey | HXNVSUGHIOWZGA-OXQOHEQNSA-N |
| XLogP | 2.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |