C25H19NO4 — CID 176522431
methyl 6-methoxy-3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate (PubChem CID 176522431) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 6-methoxy-3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate.
| Compound Name | methyl 6-methoxy-3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522431 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl 6-methoxy-3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(C#Cc3ccccc3)c2)NC(=O)c2ccc(OC)cc21 |
| InChI | InChI=1S/C25H19NO4/c1-29-20-13-14-21-22(16-20)25(24(28)30-2,26-23(21)27)19-10-6-9-18(15-19)12-11-17-7-4-3-5-8-17/h3-10,13-16H,1-2H3,(H,26,27) |
| InChIKey | PMGKQJDXZLHKTN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|