C13H20INO4 — CID 138975242
(4S)-3-[(2R,3R,4R)-2-(iodomethyl)-2,4-dimethyloxetane-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 138975242) has the molecular formula C13H20INO4 and a molecular weight of 381.21 g/mol. Its IUPAC name is (4S)-3-[(2R,3R,4R)-2-(iodomethyl)-2,4-dimethyloxetane-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3R,4R)-2-(iodomethyl)-2,4-dimethyloxetane-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138975242 |
| Molecular Formula | C13H20INO4 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (4S)-3-[(2R,3R,4R)-2-(iodomethyl)-2,4-dimethyloxetane-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)[C@@H]1[C@@H](C)O[C@@]1(C)CI |
| InChI | InChI=1S/C13H20INO4/c1-7(2)9-5-18-12(17)15(9)11(16)10-8(3)19-13(10,4)6-14/h7-10H,5-6H2,1-4H3/t8-,9-,10+,13+/m1/s1 |
| InChIKey | UBMYDQFOVUZSFR-DNJQJEMRSA-N |
| XLogP | 2.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|