C13H21NO3 — CID 91390959
(4S)-3-(5-methylhex-2-enoyl)-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 91390959) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (4S)-3-(5-methylhex-2-enoyl)-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(5-methylhex-2-enoyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91390959 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (4S)-3-(5-methylhex-2-enoyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)CC=CC(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C13H21NO3/c1-9(2)6-5-7-12(15)14-11(10(3)4)8-17-13(14)16/h5,7,9-11H,6,8H2,1-4H3/t11-/m1/s1 |
| InChIKey | UJEUIJVXFKIBAP-LLVKDONJSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|