C15H12F5NO3 — CID 90706229
(4S)-3-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 90706229) has the molecular formula C15H12F5NO3 and a molecular weight of 349.26 g/mol. Its IUPAC name is (4S)-3-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90706229 |
| Molecular Formula | C15H12F5NO3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (4S)-3-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)C=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H12F5NO3/c1-6(2)8-5-24-15(23)21(8)9(22)4-3-7-10(16)12(18)14(20)13(19)11(7)17/h3-4,6,8H,5H2,1-2H3/t8-/m1/s1 |
| InChIKey | IUBMBOUZXQHLKO-MRVPVSSYSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|