C10H15NO2S — CID 15891661
(E)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]but-2-en-1-one (PubChem CID 15891661) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (E)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 15891661 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (E)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1C(=S)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C10H15NO2S/c1-4-5-9(12)11-8(7(2)3)6-13-10(11)14/h4-5,7-8H,6H2,1-3H3/b5-4+/t8-/m1/s1 |
| InChIKey | DWJYBKQBGSHAHH-WTSVBCDHSA-N |
| XLogP | 1.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|