C18H23NO6 — CID 11314073
(4S)-4-propan-2-yl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11314073) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-propan-2-yl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11314073 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4S)-4-propan-2-yl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(/C=C/C(=O)N2C(=O)OC[C@@H]2C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H23NO6/c1-11(2)13-10-25-18(21)19(13)16(20)7-6-12-8-14(22-3)17(24-5)15(9-12)23-4/h6-9,11,13H,10H2,1-5H3/b7-6+/t13-/m1/s1 |
| InChIKey | YDNSOBHFCRJAQY-KTRBRXNASA-N |
| XLogP | 2.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|