C19H22N2O7 — CID 117054364
3-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrrolidin-3-yl]-1,3-oxazolidine-2,4-dione (PubChem CID 117054364) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrrolidin-3-yl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrrolidin-3-yl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 117054364 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrrolidin-3-yl]-1,3-oxazolidine-2,4-dione |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(N3C(=O)COC3=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N2O7/c1-25-14-8-12(9-15(26-2)18(14)27-3)4-5-16(22)20-7-6-13(10-20)21-17(23)11-28-19(21)24/h4-5,8-9,13H,6-7,10-11H2,1-3H3/b5-4+ |
| InChIKey | LUBDERAHDDTZPR-SNAWJCMRSA-N |
| XLogP | 1.31 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|