C16H20O2 — CID 138975447
5-hydroxy-4,7-dimethyl-5-phenylocta-1,7-dien-3-one (PubChem CID 138975447) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 5-hydroxy-4,7-dimethyl-5-phenylocta-1,7-dien-3-one.
| Compound Name | 5-hydroxy-4,7-dimethyl-5-phenylocta-1,7-dien-3-one |
|---|---|
| PubChem CID | 138975447 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 5-hydroxy-4,7-dimethyl-5-phenylocta-1,7-dien-3-one |
| SMILES | C=CC(=O)C(C)C(O)(CC(=C)C)c1ccccc1 |
| InChI | InChI=1S/C16H20O2/c1-5-15(17)13(4)16(18,11-12(2)3)14-9-7-6-8-10-14/h5-10,13,18H,1-2,11H2,3-4H3 |
| InChIKey | VGVOZDDFTDYZIW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|