C30H27F2NO4 — CID 138975612
diethyl 2,6-bis(4-fluorophenyl)-1-methyl-2-phenylpyridine-3,5-dicarboxylate (PubChem CID 138975612) has the molecular formula C30H27F2NO4 and a molecular weight of 503.55 g/mol. Its IUPAC name is diethyl 2,6-bis(4-fluorophenyl)-1-methyl-2-phenylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-bis(4-fluorophenyl)-1-methyl-2-phenylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 138975612 |
| Molecular Formula | C30H27F2NO4 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | diethyl 2,6-bis(4-fluorophenyl)-1-methyl-2-phenylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(C(=O)OCC)=C(c2ccc(F)cc2)N(C)C1(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27F2NO4/c1-4-36-28(34)25-19-26(29(35)37-5-2)30(21-9-7-6-8-10-21,22-13-17-24(32)18-14-22)33(3)27(25)20-11-15-23(31)16-12-20/h6-19H,4-5H2,1-3H3 |
| InChIKey | HYSNDXKGVRKOSX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |