C12H17NO6 — CID 138975750
(3S,4S,5S)-3-[(E)-3-(3-ethyloxiran-2-yl)prop-2-enoyl]-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 138975750) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (3S,4S,5S)-3-[(E)-3-(3-ethyloxiran-2-yl)prop-2-enoyl]-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-3-[(E)-3-(3-ethyloxiran-2-yl)prop-2-enoyl]-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138975750 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (3S,4S,5S)-3-[(E)-3-(3-ethyloxiran-2-yl)prop-2-enoyl]-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | CCC1OC1/C=C/C(=O)[C@]1(O)C(=O)N[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C12H17NO6/c1-2-7-8(19-7)3-4-9(15)12(18)10(16)6(5-14)13-11(12)17/h3-4,6-8,10,14,16,18H,2,5H2,1H3,(H,13,17)/b4-3+/t6-,7?,8?,10-,12+/m0/s1 |
| InChIKey | VNHRQYTUILPWAZ-GADCNRDSSA-N |
| XLogP | -2.13 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|