C19H31NO6 — CID 91417683
(3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)-3-[3-[(2R,3R)-3-nonyloxiran-2-yl]prop-2-enoyl]pyrrolidin-2-one (PubChem CID 91417683) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)-3-[3-[(2R,3R)-3-nonyloxiran-2-yl]prop-2-enoyl]pyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)-3-[3-[(2R,3R)-3-nonyloxiran-2-yl]prop-2-enoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91417683 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)-3-[3-[(2R,3R)-3-nonyloxiran-2-yl]prop-2-enoyl]pyrrolidin-2-one |
| SMILES | CCCCCCCCC[C@H]1O[C@@H]1C=CC(=O)[C@]1(O)C(=O)N[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C19H31NO6/c1-2-3-4-5-6-7-8-9-14-15(26-14)10-11-16(22)19(25)17(23)13(12-21)20-18(19)24/h10-11,13-15,17,21,23,25H,2-9,12H2,1H3,(H,20,24)/t13-,14+,15+,17-,19+/m0/s1 |
| InChIKey | BOWRHOKHYKPEAR-WCUVPALXSA-N |
| XLogP | 0.60 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|