C14H24BrNO2 — CID 138976277
(2S)-2-[(3R,4S)-4-bromohept-6-en-3-yl]oxy-N,N-dimethylpent-4-enamide (PubChem CID 138976277) has the molecular formula C14H24BrNO2 and a molecular weight of 318.26 g/mol. Its IUPAC name is (2S)-2-[(3R,4S)-4-bromohept-6-en-3-yl]oxy-N,N-dimethylpent-4-enamide.
| Compound Name | (2S)-2-[(3R,4S)-4-bromohept-6-en-3-yl]oxy-N,N-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 138976277 |
| Molecular Formula | C14H24BrNO2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2S)-2-[(3R,4S)-4-bromohept-6-en-3-yl]oxy-N,N-dimethylpent-4-enamide |
| SMILES | C=CC[C@H](O[C@H](CC)[C@@H](Br)CC=C)C(=O)N(C)C |
| InChI | InChI=1S/C14H24BrNO2/c1-6-9-11(15)12(8-3)18-13(10-7-2)14(17)16(4)5/h6-7,11-13H,1-2,8-10H2,3-5H3/t11-,12+,13-/m0/s1 |
| InChIKey | DGSWZXWUTVAWOH-XQQFMLRXSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|