C23H22N4O — CID 138976307
2,2-dimethyl-3-(1-phenylbenzimidazol-2-yl)-N-pyridin-2-ylpropanamide (PubChem CID 138976307) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 2,2-dimethyl-3-(1-phenylbenzimidazol-2-yl)-N-pyridin-2-ylpropanamide.
| Compound Name | 2,2-dimethyl-3-(1-phenylbenzimidazol-2-yl)-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 138976307 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2,2-dimethyl-3-(1-phenylbenzimidazol-2-yl)-N-pyridin-2-ylpropanamide |
| SMILES | CC(C)(Cc1nc2ccccc2n1-c1ccccc1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C23H22N4O/c1-23(2,22(28)26-20-14-8-9-15-24-20)16-21-25-18-12-6-7-13-19(18)27(21)17-10-4-3-5-11-17/h3-15H,16H2,1-2H3,(H,24,26,28) |
| InChIKey | JINMYFOKGZBCMP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |