C21H28BF2NO4 — CID 138976354
(Z)-2,2-difluoro-3-methyl-1-morpholin-4-yl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-one (PubChem CID 138976354) has the molecular formula C21H28BF2NO4 and a molecular weight of 407.27 g/mol. Its IUPAC name is (Z)-2,2-difluoro-3-methyl-1-morpholin-4-yl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-one.
| Compound Name | (Z)-2,2-difluoro-3-methyl-1-morpholin-4-yl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-one |
|---|---|
| PubChem CID | 138976354 |
| Molecular Formula | C21H28BF2NO4 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (Z)-2,2-difluoro-3-methyl-1-morpholin-4-yl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-one |
| SMILES | C/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccccc1)C(F)(F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H28BF2NO4/c1-15(21(23,24)18(26)25-11-13-27-14-12-25)17(16-9-7-6-8-10-16)22-28-19(2,3)20(4,5)29-22/h6-10H,11-14H2,1-5H3/b17-15+ |
| InChIKey | QJHZFTOPBVBYOY-BMRADRMJSA-N |
| XLogP | 3.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|