C21H30BF2NO3 — CID 138976353
(Z)-N,N-diethyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide (PubChem CID 138976353) has the molecular formula C21H30BF2NO3 and a molecular weight of 393.28 g/mol. Its IUPAC name is (Z)-N,N-diethyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide.
| Compound Name | (Z)-N,N-diethyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 138976353 |
| Molecular Formula | C21H30BF2NO3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (Z)-N,N-diethyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
| SMILES | CCN(CC)C(=O)C(F)(F)/C(C)=C(/B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C21H30BF2NO3/c1-8-25(9-2)18(26)21(23,24)15(3)17(16-13-11-10-12-14-16)22-27-19(4,5)20(6,7)28-22/h10-14H,8-9H2,1-7H3/b17-15+ |
| InChIKey | PMZUNTBBTPELPN-BMRADRMJSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|