C20H28BF2NO3 — CID 154718490
(Z)-2,2-difluoro-3-methyl-4-phenyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide (PubChem CID 154718490) has the molecular formula C20H28BF2NO3 and a molecular weight of 379.26 g/mol. Its IUPAC name is (Z)-2,2-difluoro-3-methyl-4-phenyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide.
| Compound Name | (Z)-2,2-difluoro-3-methyl-4-phenyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 154718490 |
| Molecular Formula | C20H28BF2NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (Z)-2,2-difluoro-3-methyl-4-phenyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
| SMILES | C/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccccc1)C(F)(F)C(=O)NC(C)C |
| InChI | InChI=1S/C20H28BF2NO3/c1-13(2)24-17(25)20(22,23)14(3)16(15-11-9-8-10-12-15)21-26-18(4,5)19(6,7)27-21/h8-13H,1-7H3,(H,24,25)/b16-14+ |
| InChIKey | RJUCGZXSEWSFEN-JQIJEIRASA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|