C19H27BF3NO3 — CID 154713271
2,2-dimethyl-N-[(R)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 154713271) has the molecular formula C19H27BF3NO3 and a molecular weight of 385.24 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(R)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(R)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 154713271 |
| Molecular Formula | C19H27BF3NO3 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2,2-dimethyl-N-[(R)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N[C@H](B1OC(C)(C)C(C)(C)O1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H27BF3NO3/c1-16(2,3)15(25)24-14(20-26-17(4,5)18(6,7)27-20)12-8-10-13(11-9-12)19(21,22)23/h8-11,14H,1-7H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | LTHPPQDIQRSYMR-AWEZNQCLSA-N |
| XLogP | 4.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|