C23H25BF3NO3 — CID 146167155
(E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 146167155) has the molecular formula C23H25BF3NO3 and a molecular weight of 431.26 g/mol. Its IUPAC name is (E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 146167155 |
| Molecular Formula | C23H25BF3NO3 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CC1(C)OB(c2ccc(/C=C/C(=O)NCc3ccc(C(F)(F)F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H25BF3NO3/c1-21(2)22(3,4)31-24(30-21)19-12-7-16(8-13-19)9-14-20(29)28-15-17-5-10-18(11-6-17)23(25,26)27/h5-14H,15H2,1-4H3,(H,28,29)/b14-9+ |
| InChIKey | MTZKNDGYKDIYIQ-NTEUORMPSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|