C26H32BF2NO3 — CID 138976355
(Z)-2,2-difluoro-3-methyl-4-phenyl-N-(3-phenylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide (PubChem CID 138976355) has the molecular formula C26H32BF2NO3 and a molecular weight of 455.35 g/mol. Its IUPAC name is (Z)-2,2-difluoro-3-methyl-4-phenyl-N-(3-phenylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide.
| Compound Name | (Z)-2,2-difluoro-3-methyl-4-phenyl-N-(3-phenylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 138976355 |
| Molecular Formula | C26H32BF2NO3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (Z)-2,2-difluoro-3-methyl-4-phenyl-N-(3-phenylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
| SMILES | C/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccccc1)C(F)(F)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H32BF2NO3/c1-19(26(28,29)23(31)30-18-12-15-20-13-8-6-9-14-20)22(21-16-10-7-11-17-21)27-32-24(2,3)25(4,5)33-27/h6-11,13-14,16-17H,12,15,18H2,1-5H3,(H,30,31)/b22-19+ |
| InChIKey | MHZLLCWVBCKYBM-ZBJSNUHESA-N |
| XLogP | 5.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|