C24H28BF2NO3 — CID 154711413
(Z)-N-benzyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide (PubChem CID 154711413) has the molecular formula C24H28BF2NO3 and a molecular weight of 427.30 g/mol. Its IUPAC name is (Z)-N-benzyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide.
| Compound Name | (Z)-N-benzyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 154711413 |
| Molecular Formula | C24H28BF2NO3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (Z)-N-benzyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
| SMILES | C/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccccc1)C(F)(F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H28BF2NO3/c1-17(24(26,27)21(29)28-16-18-12-8-6-9-13-18)20(19-14-10-7-11-15-19)25-30-22(2,3)23(4,5)31-25/h6-15H,16H2,1-5H3,(H,28,29)/b20-17+ |
| InChIKey | JQXPRXARWWIRKR-LVZFUZTISA-N |
| XLogP | 5.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|