C23H32BF2NO3 — CID 154711601
(Z)-N-cyclohexyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide (PubChem CID 154711601) has the molecular formula C23H32BF2NO3 and a molecular weight of 419.32 g/mol. Its IUPAC name is (Z)-N-cyclohexyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide.
| Compound Name | (Z)-N-cyclohexyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 154711601 |
| Molecular Formula | C23H32BF2NO3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (Z)-N-cyclohexyl-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enamide |
| SMILES | C/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccccc1)C(F)(F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H32BF2NO3/c1-16(23(25,26)20(28)27-18-14-10-7-11-15-18)19(17-12-8-6-9-13-17)24-29-21(2,3)22(4,5)30-24/h6,8-9,12-13,18H,7,10-11,14-15H2,1-5H3,(H,27,28)/b19-16+ |
| InChIKey | OFSFHJSMOFZOKD-KNTRCKAVSA-N |
| XLogP | 5.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|